Valine
1.Assay:99.0% 2.pH:6.0 3.Specific rotation:+28.09 4.STANDARD:USP24 5.SHELF LIFE:2Years
CAS NO: | 72-18-4;7004-03-7 |
Molecular Weight: | 117.1478 |
EC NO: | 202-713-4 |
Molecular Formula: | C5H11NO2 |
InChI: | InChI:1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
Constitutional Formula: |
|
Item | Limits | Test results |
Identification | Conordant with the referennce spectrum | Conforms |
Assay | 98.5~101.5 | 99.0 |
pH | 5.5~7.0 | 6.0 |
Specific rotation | +26.6°~+28.8° | +28.09° |
Residue on ignition | ≤0.10 | <0.1 |
Loss on drying | ≤0.30 | 0.19 |
Chloride | ≤0.05 | <0.05 |
Iron | ≤30.0 | <30 |
Sulfate | ≤0.03 | <0.03 |
Heavy metals | ≤15.0 | <0.15 |
Organic | Meets the requiremnts | Conforms |
Valine